C25H33N3O2S — CID 167423532
(1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(1,3-thiazol-4-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol (PubChem CID 167423532) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is (1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(1,3-thiazol-4-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(1,3-thiazol-4-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 167423532 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(1,3-thiazol-4-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
| SMILES | Oc1ccc2c(c1)[C@@]13CCN(CCc4cscn4)CC[C@@]1(O)[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C25H33N3O2S/c29-21-4-3-19-13-23-25(30)8-11-27(9-5-20-16-31-17-26-20)10-6-24(25,22(19)14-21)7-12-28(23)15-18-1-2-18/h3-4,14,16-18,23,29-30H,1-2,5-13,15H2/t23-,24+,25-/m1/s1 |
| InChIKey | FVDPGYZDXSZLJK-DSNGMDLFSA-N |
| XLogP | 3.20 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |