C22H31NO2 — CID 123514689
16-(cyclopropylmethyl)-12-propan-2-yl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,10-diol (PubChem CID 123514689) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 16-(cyclopropylmethyl)-12-propan-2-yl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | 16-(cyclopropylmethyl)-12-propan-2-yl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 123514689 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 16-(cyclopropylmethyl)-12-propan-2-yl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,10-diol |
| SMILES | CC(C)C1CC23CCN(CC4CC4)C(Cc4ccc(O)cc42)C3(O)C1 |
| InChI | InChI=1S/C22H31NO2/c1-14(2)17-11-21-7-8-23(13-15-3-4-15)20(22(21,25)12-17)9-16-5-6-18(24)10-19(16)21/h5-6,10,14-15,17,20,24-25H,3-4,7-9,11-13H2,1-2H3 |
| InChIKey | PXVZIOJJULHRTK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |