C25H36N2O3 — CID 123925888
N-[17-(cyclopropylmethyl)-4,10-dihydroxy-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide (PubChem CID 123925888) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[17-(cyclopropylmethyl)-4,10-dihydroxy-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide.
| Compound Name | N-[17-(cyclopropylmethyl)-4,10-dihydroxy-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 123925888 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-[17-(cyclopropylmethyl)-4,10-dihydroxy-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1CC2(O)C3Cc4ccc(O)cc4C2(CCN3CC2CC2)CC1C |
| InChI | InChI=1S/C25H36N2O3/c1-15(2)23(29)26-21-13-25(30)22-10-18-6-7-19(28)11-20(18)24(25,12-16(21)3)8-9-27(22)14-17-4-5-17/h6-7,11,15-17,21-22,28,30H,4-5,8-10,12-14H2,1-3H3,(H,26,29) |
| InChIKey | ADDFKSGOZGVMHR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |