C25H36N2O2 — CID 159968567
N-[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-10-hydroxy-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide (PubChem CID 159968567) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is N-[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-10-hydroxy-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide.
| Compound Name | N-[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-10-hydroxy-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 159968567 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | N-[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-10-hydroxy-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]-2-methylpropanamide |
| SMILES | Cc1ccc2c(c1)[C@@]13CC[C@H](NC(=O)C(C)C)C[C@@]1(O)[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C25H36N2O2/c1-16(2)23(28)26-20-8-9-24-10-11-27(15-18-5-6-18)22(25(24,29)14-20)13-19-7-4-17(3)12-21(19)24/h4,7,12,16,18,20,22,29H,5-6,8-11,13-15H2,1-3H3,(H,26,28)/t20-,22+,24-,25+/m0/s1 |
| InChIKey | ZNHQUBIIXNUNAL-HYLPIGKTSA-N |
| XLogP | 3.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |