C23H34N4O2 — CID 144876982
N'-[2-[[17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]ethyl]methanimidamide (PubChem CID 144876982) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N'-[2-[[17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]ethyl]methanimidamide.
| Compound Name | N'-[2-[[17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]ethyl]methanimidamide |
|---|---|
| PubChem CID | 144876982 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N'-[2-[[17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]ethyl]methanimidamide |
| SMILES | N/C=N/CCNC1CCC23CCN(CC4CC4)C(Cc4ccc(O)cc42)C3(O)C1 |
| InChI | InChI=1S/C23H34N4O2/c24-15-25-8-9-26-18-5-6-22-7-10-27(14-16-1-2-16)21(23(22,29)13-18)11-17-3-4-19(28)12-20(17)22/h3-4,12,15-16,18,21,26,28-29H,1-2,5-11,13-14H2,(H2,24,25) |
| InChIKey | ZOZWGNZKGUXYQH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|