C20H28N2O2 — CID 167423400
(1S,9R,10S)-18-(cyclopropylmethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol (PubChem CID 167423400) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (1S,9R,10S)-18-(cyclopropylmethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1S,9R,10S)-18-(cyclopropylmethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 167423400 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (1S,9R,10S)-18-(cyclopropylmethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
| SMILES | Oc1ccc2c(c1)[C@@]13CCNCC[C@@]1(O)[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C20H28N2O2/c23-16-4-3-15-11-18-20(24)6-9-21-8-5-19(20,17(15)12-16)7-10-22(18)13-14-1-2-14/h3-4,12,14,18,21,23-24H,1-2,5-11,13H2/t18-,19+,20-/m1/s1 |
| InChIKey | JFTSAAGPYHGBCC-HSALFYBXSA-N |
| XLogP | 1.78 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |