C24H36N4O2 — CID 158015683
4-[[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]butanimidamide (PubChem CID 158015683) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 4-[[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]butanimidamide.
| Compound Name | 4-[[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]butanimidamide |
|---|---|
| PubChem CID | 158015683 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 4-[[(1S,9R,10S,12S)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]amino]butanimidamide |
| SMILES | [H]/N=C(\N)CCCN[C@H]1CC[C@]23CCN(CC4CC4)[C@H](Cc4ccc(O)cc42)[C@]3(O)C1 |
| InChI | InChI=1S/C24H36N4O2/c25-22(26)2-1-10-27-18-7-8-23-9-11-28(15-16-3-4-16)21(24(23,30)14-18)12-17-5-6-19(29)13-20(17)23/h5-6,13,16,18,21,27,29-30H,1-4,7-12,14-15H2,(H3,25,26)/t18-,21+,23-,24+/m0/s1 |
| InChIKey | GXYVTHRRRVTKGR-IZSMGAQTSA-N |
| XLogP | 2.26 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|