C27H37NO3 — CID 77104974
(1R,9R,10S,12S)-12-(cyclohexylmethyl)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 77104974) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is (1R,9R,10S,12S)-12-(cyclohexylmethyl)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9R,10S,12S)-12-(cyclohexylmethyl)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 77104974 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (1R,9R,10S,12S)-12-(cyclohexylmethyl)-17-(cyclopropylmethyl)-4,10-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | O=C1C[C@]23CCN(CC4CC4)[C@H](Cc4ccc(O)cc42)[C@]3(O)C[C@@H]1CC1CCCCC1 |
| InChI | InChI=1S/C27H37NO3/c29-22-9-8-20-13-25-27(31)15-21(12-18-4-2-1-3-5-18)24(30)16-26(27,23(20)14-22)10-11-28(25)17-19-6-7-19/h8-9,14,18-19,21,25,29,31H,1-7,10-13,15-17H2/t21-,25+,26+,27+/m0/s1 |
| InChIKey | VKWQNOCLLHSGNW-IZIBRLFBSA-N |
| XLogP | 4.35 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |