C28H35NO3 — CID 122664476
(1R,9R,10S)-17-(cyclopropylmethyl)-4-methyl-12-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol (PubChem CID 122664476) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is (1R,9R,10S)-17-(cyclopropylmethyl)-4-methyl-12-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol.
| Compound Name | (1R,9R,10S)-17-(cyclopropylmethyl)-4-methyl-12-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol |
|---|---|
| PubChem CID | 122664476 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (1R,9R,10S)-17-(cyclopropylmethyl)-4-methyl-12-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol |
| SMILES | Cc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)[C@]1(O)CC(OCc1ccccc1)C(O)C3 |
| InChI | InChI=1S/C28H35NO3/c1-19-7-10-22-14-26-28(31)16-25(32-18-21-5-3-2-4-6-21)24(30)15-27(28,23(22)13-19)11-12-29(26)17-20-8-9-20/h2-7,10,13,20,24-26,30-31H,8-9,11-12,14-18H2,1H3/t24?,25?,26-,27-,28-/m1/s1 |
| InChIKey | LYMVRCMLJFXGQA-KTWGYSIQSA-N |
| XLogP | 3.74 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |