C36H44N2O2 — CID 126492881
(1R,9R,10S,13S)-17-(cyclopropylmethyl)-13-(dibenzylamino)-13-(hydroxymethyl)-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol (PubChem CID 126492881) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is (1R,9R,10S,13S)-17-(cyclopropylmethyl)-13-(dibenzylamino)-13-(hydroxymethyl)-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol.
| Compound Name | (1R,9R,10S,13S)-17-(cyclopropylmethyl)-13-(dibenzylamino)-13-(hydroxymethyl)-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
|---|---|
| PubChem CID | 126492881 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | (1R,9R,10S,13S)-17-(cyclopropylmethyl)-13-(dibenzylamino)-13-(hydroxymethyl)-4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
| SMILES | Cc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)[C@]1(O)CC[C@](CO)(N(Cc1ccccc1)Cc1ccccc1)C3 |
| InChI | InChI=1S/C36H44N2O2/c1-27-12-15-31-21-33-36(40)17-16-34(26-39,25-35(36,32(31)20-27)18-19-37(33)22-30-13-14-30)38(23-28-8-4-2-5-9-28)24-29-10-6-3-7-11-29/h2-12,15,20,30,33,39-40H,13-14,16-19,21-26H2,1H3/t33-,34+,35-,36-/m1/s1 |
| InChIKey | TWERGIAVRJSQFD-IYKITFJXSA-N |
| XLogP | 5.62 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |