C36H42N2O — CID 126492891
(1R,9R,10S,13S)-N,N-dibenzyl-17-(cyclopropylmethyl)-4-methyl-11-oxa-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2(7),3,5-trien-13-amine (PubChem CID 126492891) has the molecular formula C36H42N2O and a molecular weight of 518.75 g/mol. Its IUPAC name is (1R,9R,10S,13S)-N,N-dibenzyl-17-(cyclopropylmethyl)-4-methyl-11-oxa-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2(7),3,5-trien-13-amine.
| Compound Name | (1R,9R,10S,13S)-N,N-dibenzyl-17-(cyclopropylmethyl)-4-methyl-11-oxa-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2(7),3,5-trien-13-amine |
|---|---|
| PubChem CID | 126492891 |
| Molecular Formula | C36H42N2O |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | (1R,9R,10S,13S)-N,N-dibenzyl-17-(cyclopropylmethyl)-4-methyl-11-oxa-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2(7),3,5-trien-13-amine |
| SMILES | Cc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)[C@]12CC[C@@](N(Cc1ccccc1)Cc1ccccc1)(CO2)C3 |
| InChI | InChI=1S/C36H42N2O/c1-27-12-15-31-21-33-36-17-16-34(26-39-36,25-35(36,32(31)20-27)18-19-37(33)22-30-13-14-30)38(23-28-8-4-2-5-9-28)24-29-10-6-3-7-11-29/h2-12,15,20,30,33H,13-14,16-19,21-26H2,1H3/t33-,34+,35-,36-/m1/s1 |
| InChIKey | MTWXZKJCNACKDF-IYKITFJXSA-N |
| XLogP | 6.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |