C23H33NO2 — CID 70357588
(1R,9R,10R)-17-(cyclopropylmethyl)-10-ethyl-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol (PubChem CID 70357588) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclopropylmethyl)-10-ethyl-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol.
| Compound Name | (1R,9R,10R)-17-(cyclopropylmethyl)-10-ethyl-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol |
|---|---|
| PubChem CID | 70357588 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (1R,9R,10R)-17-(cyclopropylmethyl)-10-ethyl-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol |
| SMILES | CC[C@@]12CCC(C)(O)C[C@@]13CCN(CC1CC1)[C@@H]2Cc1ccc(O)cc13 |
| InChI | InChI=1S/C23H33NO2/c1-3-22-9-8-21(2,26)15-23(22)10-11-24(14-16-4-5-16)20(22)12-17-6-7-18(25)13-19(17)23/h6-7,13,16,20,25-26H,3-5,8-12,14-15H2,1-2H3/t20-,21?,22+,23-/m1/s1 |
| InChIKey | HIUYMJIVJBEPIV-FJPMACBPSA-N |
| XLogP | 4.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |