C28H37N3O2 — CID 172833432
(1S,9R,10S)-18-(cyclopropylmethyl)-4-methoxy-13-(2-pyridin-2-ylethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-10-ol (PubChem CID 172833432) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is (1S,9R,10S)-18-(cyclopropylmethyl)-4-methoxy-13-(2-pyridin-2-ylethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-10-ol.
| Compound Name | (1S,9R,10S)-18-(cyclopropylmethyl)-4-methoxy-13-(2-pyridin-2-ylethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-10-ol |
|---|---|
| PubChem CID | 172833432 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (1S,9R,10S)-18-(cyclopropylmethyl)-4-methoxy-13-(2-pyridin-2-ylethyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-10-ol |
| SMILES | COc1ccc2c(c1)[C@@]13CCN(CCc4ccccn4)CC[C@@]1(O)[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C28H37N3O2/c1-33-24-8-7-22-18-26-28(32)12-16-30(14-9-23-4-2-3-13-29-23)15-10-27(28,25(22)19-24)11-17-31(26)20-21-5-6-21/h2-4,7-8,13,19,21,26,32H,5-6,9-12,14-18,20H2,1H3/t26-,27+,28-/m1/s1 |
| InChIKey | VVABSODWEIGVEU-OZNIXHKMSA-N |
| XLogP | 3.44 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |