C28H34ClN3O3 — CID 172758871
1-[(1R,9R,10S)-5-chloro-18-(cyclopropylmethyl)-10-hydroxy-4-methoxy-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2,4,6-trien-13-yl]-2-pyridin-2-ylethanone (PubChem CID 172758871) has the molecular formula C28H34ClN3O3 and a molecular weight of 496.05 g/mol. Its IUPAC name is 1-[(1R,9R,10S)-5-chloro-18-(cyclopropylmethyl)-10-hydroxy-4-methoxy-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2,4,6-trien-13-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[(1R,9R,10S)-5-chloro-18-(cyclopropylmethyl)-10-hydroxy-4-methoxy-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2,4,6-trien-13-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 172758871 |
| Molecular Formula | C28H34ClN3O3 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-[(1R,9R,10S)-5-chloro-18-(cyclopropylmethyl)-10-hydroxy-4-methoxy-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2,4,6-trien-13-yl]-2-pyridin-2-ylethanone |
| SMILES | COc1cc2c(cc1Cl)C[C@H]1N(CC3CC3)CC[C@@]23CCN(C(=O)Cc2ccccn2)CC[C@@]13O |
| InChI | InChI=1S/C28H34ClN3O3/c1-35-24-17-22-20(14-23(24)29)15-25-28(34)9-13-31(26(33)16-21-4-2-3-10-30-21)11-7-27(22,28)8-12-32(25)18-19-5-6-19/h2-4,10,14,17,19,25,34H,5-9,11-13,15-16,18H2,1H3/t25-,27+,28-/m1/s1 |
| InChIKey | LKFJIETZJBRTRK-FPNNDXFKSA-N |
| XLogP | 3.62 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |