C35H38F3N3O6S — CID 172851388
[(1R,9R,10S)-18-(cyclopropylmethyl)-10-hydroxy-3-phenylmethoxy-13-(2-pyridin-2-ylacetyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 172851388) has the molecular formula C35H38F3N3O6S and a molecular weight of 685.77 g/mol. Its IUPAC name is [(1R,9R,10S)-18-(cyclopropylmethyl)-10-hydroxy-3-phenylmethoxy-13-(2-pyridin-2-ylacetyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,9R,10S)-18-(cyclopropylmethyl)-10-hydroxy-3-phenylmethoxy-13-(2-pyridin-2-ylacetyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172851388 |
| Molecular Formula | C35H38F3N3O6S |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.24 |
| IUPAC Name | [(1R,9R,10S)-18-(cyclopropylmethyl)-10-hydroxy-3-phenylmethoxy-13-(2-pyridin-2-ylacetyl)-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | O=C(Cc1ccccn1)N1CC[C@]23CCN(CC4CC4)[C@H](Cc4ccc(OS(=O)(=O)C(F)(F)F)c(OCc5ccccc5)c42)[C@]3(O)CC1 |
| InChI | InChI=1S/C35H38F3N3O6S/c36-35(37,38)48(44,45)47-28-12-11-26-20-29-34(43)15-19-40(30(42)21-27-8-4-5-16-39-27)17-13-33(34,14-18-41(29)22-24-9-10-24)31(26)32(28)46-23-25-6-2-1-3-7-25/h1-8,11-12,16,24,29,43H,9-10,13-15,17-23H2/t29-,33+,34-/m1/s1 |
| InChIKey | YCPVRPSHCFSEJQ-IUXHJFJISA-N |
| XLogP | 4.76 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|