C34H35NO7 — CID 146299351
2-[5-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]naphthalen-1-yl]acetic acid (PubChem CID 146299351) has the molecular formula C34H35NO7 and a molecular weight of 569.65 g/mol. Its IUPAC name is 2-[5-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]naphthalen-1-yl]acetic acid.
| Compound Name | 2-[5-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]naphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 146299351 |
| Molecular Formula | C34H35NO7 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 2-[5-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]naphthalen-1-yl]acetic acid |
| SMILES | O=C(O)Cc1cccc2c(CC(=O)Oc3ccc4c(c3O)C35CCN(CC6CC6)C(C4)C3(O)CCC(=O)C5)cccc12 |
| InChI | InChI=1S/C34H35NO7/c36-24-11-12-34(41)28-15-23-9-10-27(32(40)31(23)33(34,18-24)13-14-35(28)19-20-7-8-20)42-30(39)17-22-4-2-5-25-21(16-29(37)38)3-1-6-26(22)25/h1-6,9-10,20,28,40-41H,7-8,11-19H2,(H,37,38) |
| InChIKey | PKIVIDBRJUPPDA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|