C30H31NO7S2 — CID 146300540
2-[4-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]thieno[2,3-b]thiophen-3-yl]acetic acid (PubChem CID 146300540) has the molecular formula C30H31NO7S2 and a molecular weight of 581.71 g/mol. Its IUPAC name is 2-[4-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]thieno[2,3-b]thiophen-3-yl]acetic acid.
| Compound Name | 2-[4-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]thieno[2,3-b]thiophen-3-yl]acetic acid |
|---|---|
| PubChem CID | 146300540 |
| Molecular Formula | C30H31NO7S2 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 2-[4-[2-[[17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-oxoethyl]thieno[2,3-b]thiophen-3-yl]acetic acid |
| SMILES | O=C(O)Cc1csc2scc(CC(=O)Oc3ccc4c(c3O)C35CCN(CC6CC6)C(C4)C3(O)CCC(=O)C5)c12 |
| InChI | InChI=1S/C30H31NO7S2/c32-20-5-6-30(37)22-9-17-3-4-21(27(36)26(17)29(30,12-20)7-8-31(22)13-16-1-2-16)38-24(35)11-19-15-40-28-25(19)18(14-39-28)10-23(33)34/h3-4,14-16,22,36-37H,1-2,5-13H2,(H,33,34) |
| InChIKey | UKRWOJFJGQUORU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|