C30H31N3O4 — CID 156801189
1-[(1S,5R,13R,18S)-4-benzyl-10,18-dihydroxy-12-oxa-4,15-diazapentacyclo[9.7.1.01,13.05,18.07,19]nonadeca-7(19),8,10-trien-15-yl]-2-pyridin-2-ylethanone (PubChem CID 156801189) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 1-[(1S,5R,13R,18S)-4-benzyl-10,18-dihydroxy-12-oxa-4,15-diazapentacyclo[9.7.1.01,13.05,18.07,19]nonadeca-7(19),8,10-trien-15-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[(1S,5R,13R,18S)-4-benzyl-10,18-dihydroxy-12-oxa-4,15-diazapentacyclo[9.7.1.01,13.05,18.07,19]nonadeca-7(19),8,10-trien-15-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 156801189 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 1-[(1S,5R,13R,18S)-4-benzyl-10,18-dihydroxy-12-oxa-4,15-diazapentacyclo[9.7.1.01,13.05,18.07,19]nonadeca-7(19),8,10-trien-15-yl]-2-pyridin-2-ylethanone |
| SMILES | O=C(Cc1ccccn1)N1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3Cc2ccccc2)[C@H](C1)O5 |
| InChI | InChI=1S/C30H31N3O4/c34-23-10-9-21-16-24-30(36)12-15-33(26(35)17-22-8-4-5-13-31-22)19-25-29(30,27(21)28(23)37-25)11-14-32(24)18-20-6-2-1-3-7-20/h1-10,13,24-25,34,36H,11-12,14-19H2/t24-,25+,29-,30-/m1/s1 |
| InChIKey | JFXSWYPFLBXFFH-LPKQAODOSA-N |
| XLogP | 2.82 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |