C28H37N3O3 — CID 167423546
(1S,10S)-18-(cyclopropylmethyl)-13-[2-(6-methoxy-2-pyridinyl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol (PubChem CID 167423546) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (1S,10S)-18-(cyclopropylmethyl)-13-[2-(6-methoxy-2-pyridinyl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1S,10S)-18-(cyclopropylmethyl)-13-[2-(6-methoxy-2-pyridinyl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 167423546 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (1S,10S)-18-(cyclopropylmethyl)-13-[2-(6-methoxy-2-pyridinyl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
| SMILES | COc1cccc(CCN2CC[C@]34CCN(CC5CC5)C(Cc5ccc(O)cc53)[C@]4(O)CC2)n1 |
| InChI | InChI=1S/C28H37N3O3/c1-34-26-4-2-3-22(29-26)9-13-30-14-10-27-11-16-31(19-20-5-6-20)25(28(27,33)12-15-30)17-21-7-8-23(32)18-24(21)27/h2-4,7-8,18,20,25,32-33H,5-6,9-17,19H2,1H3/t25?,27-,28+/m0/s1 |
| InChIKey | HGYMCCJGGMRQLD-JOTUXTEUSA-N |
| XLogP | 3.14 |
| TPSA | 69.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |