C25H35NO2 — CID 146390034
[6-(cyclopropylmethylamino)-8-ethyl-7,8-dimethyl-6,7-dihydro-5H-naphthalen-2-yl] (2E)-5-methylhexa-2,4-dienoate (PubChem CID 146390034) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is [6-(cyclopropylmethylamino)-8-ethyl-7,8-dimethyl-6,7-dihydro-5H-naphthalen-2-yl] (2E)-5-methylhexa-2,4-dienoate.
| Compound Name | [6-(cyclopropylmethylamino)-8-ethyl-7,8-dimethyl-6,7-dihydro-5H-naphthalen-2-yl] (2E)-5-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 146390034 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | [6-(cyclopropylmethylamino)-8-ethyl-7,8-dimethyl-6,7-dihydro-5H-naphthalen-2-yl] (2E)-5-methylhexa-2,4-dienoate |
| SMILES | CCC1(C)c2cc(OC(=O)/C=C/C=C(C)C)ccc2CC(NCC2CC2)C1C |
| InChI | InChI=1S/C25H35NO2/c1-6-25(5)18(4)23(26-16-19-10-11-19)14-20-12-13-21(15-22(20)25)28-24(27)9-7-8-17(2)3/h7-9,12-13,15,18-19,23,26H,6,10-11,14,16H2,1-5H3/b9-7+ |
| InChIKey | UCMJOLCNYRVGST-VQHVLOKHSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|