C27H35NO5 — CID 146389973
[7-(cyclobutylmethylamino)-13-ethyl-8,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 146389973) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is [7-(cyclobutylmethylamino)-13-ethyl-8,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [7-(cyclobutylmethylamino)-13-ethyl-8,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 146389973 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [7-(cyclobutylmethylamino)-13-ethyl-8,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)Oc1ccc2c3c1OC1C(O)CCC(O)(C(NCC4CCC4)C2)C31CC |
| InChI | InChI=1S/C27H35NO5/c1-3-5-6-10-22(30)32-20-12-11-18-15-21(28-16-17-8-7-9-17)27(31)14-13-19(29)25-26(27,4-2)23(18)24(20)33-25/h3,5-6,10-12,17,19,21,25,28-29,31H,4,7-9,13-16H2,1-2H3/b5-3+,10-6+ |
| InChIKey | DHVWPYBMKFWYSQ-YBRHCDHNSA-N |
| XLogP | 3.33 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|