C32H34F3NO9 — CID 123342646
4-[2-[[(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-2-oxoethyl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 123342646) has the molecular formula C32H34F3NO9 and a molecular weight of 633.62 g/mol. Its IUPAC name is 4-[2-[[(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-2-oxoethyl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[[(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-2-oxoethyl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 123342646 |
| Molecular Formula | C32H34F3NO9 |
| Molecular Weight | 633.62 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 4-[2-[[(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-2-oxoethyl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1ccc(C(=O)O)cc1)Oc1ccc2c3c1O[C@H]1[C@@H](O)CC[C@@]4(O)[C@@H](C2)N(CC2CCC2)CC[C@]314.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H33NO7.C2HF3O2/c32-21-10-11-30(36)23-15-20-8-9-22(37-24(33)14-17-4-6-19(7-5-17)28(34)35)26-25(20)29(30,27(21)38-26)12-13-31(23)16-18-2-1-3-18;3-2(4,5)1(6)7/h4-9,18,21,23,27,32,36H,1-3,10-16H2,(H,34,35);(H,6,7)/t21-,23+,27-,29-,30+;/m0./s1 |
| InChIKey | FRUSGGNXECOYKF-VUCFCCPOSA-N |
| XLogP | 3.48 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|