C25H35NO6 — CID 59200785
(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-(2-methoxyethoxymethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol (PubChem CID 59200785) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-(2-methoxyethoxymethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-(2-methoxyethoxymethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
|---|---|
| PubChem CID | 59200785 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-(2-methoxyethoxymethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
| SMILES | COCCOCOc1ccc2c3c1O[C@H]1[C@@H](O)CC[C@@]4(O)[C@@H](C2)N(CC2CCC2)CC[C@]314 |
| InChI | InChI=1S/C25H35NO6/c1-29-11-12-30-15-31-19-6-5-17-13-20-25(28)8-7-18(27)23-24(25,21(17)22(19)32-23)9-10-26(20)14-16-3-2-4-16/h5-6,16,18,20,23,27-28H,2-4,7-15H2,1H3/t18-,20+,23-,24-,25+/m0/s1 |
| InChIKey | PJZKLSAUFYTVDR-QUMVDNCSSA-N |
| XLogP | 2.00 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|