C26H39NO5 — CID 126635305
(1S,10R)-11-(cyclobutylmethyl)-5-(2-methoxyethoxymethoxy)-15-methyl-2-propyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-15-ol (PubChem CID 126635305) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is (1S,10R)-11-(cyclobutylmethyl)-5-(2-methoxyethoxymethoxy)-15-methyl-2-propyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-15-ol.
| Compound Name | (1S,10R)-11-(cyclobutylmethyl)-5-(2-methoxyethoxymethoxy)-15-methyl-2-propyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-15-ol |
|---|---|
| PubChem CID | 126635305 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (1S,10R)-11-(cyclobutylmethyl)-5-(2-methoxyethoxymethoxy)-15-methyl-2-propyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-15-ol |
| SMILES | CCCC1Oc2c(OCOCCOC)ccc3c2[C@@]12CCN(CC1CCC1)[C@H](C3)C2(C)O |
| InChI | InChI=1S/C26H39NO5/c1-4-6-22-26-11-12-27(16-18-7-5-8-18)21(25(26,2)28)15-19-9-10-20(24(32-22)23(19)26)31-17-30-14-13-29-3/h9-10,18,21-22,28H,4-8,11-17H2,1-3H3/t21-,22?,25?,26-/m1/s1 |
| InChIKey | XEMULICIOMCHCB-OHDRUZIJSA-N |
| XLogP | 3.67 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|