C29H47NO6 — CID 129087638
(1S,13S)-1-butyl-10-(cyclobutylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol (PubChem CID 129087638) has the molecular formula C29H47NO6 and a molecular weight of 505.70 g/mol. Its IUPAC name is (1S,13S)-1-butyl-10-(cyclobutylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol.
| Compound Name | (1S,13S)-1-butyl-10-(cyclobutylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol |
|---|---|
| PubChem CID | 129087638 |
| Molecular Formula | C29H47NO6 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | (1S,13S)-1-butyl-10-(cyclobutylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol |
| SMILES | CCCC[C@]12CCN(CC3CCC3)C(Cc3ccc(OCCOCCOCCOC)c(O)c31)[C@@]2(C)O |
| InChI | InChI=1S/C29H47NO6/c1-4-5-11-29-12-13-30(21-22-7-6-8-22)25(28(29,2)32)20-23-9-10-24(27(31)26(23)29)36-19-18-35-17-16-34-15-14-33-3/h9-10,22,25,31-32H,4-8,11-21H2,1-3H3/t25?,28-,29+/m1/s1 |
| InChIKey | XNMHTNTWZISYPR-AQBKHMEKSA-N |
| XLogP | 4.06 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|