C26H41NO5 — CID 129085492
1-butyl-10-(cyclobutylmethyl)-4-(2-methoxyethoxymethoxy)-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol (PubChem CID 129085492) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is 1-butyl-10-(cyclobutylmethyl)-4-(2-methoxyethoxymethoxy)-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol.
| Compound Name | 1-butyl-10-(cyclobutylmethyl)-4-(2-methoxyethoxymethoxy)-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol |
|---|---|
| PubChem CID | 129085492 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 1-butyl-10-(cyclobutylmethyl)-4-(2-methoxyethoxymethoxy)-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,13-diol |
| SMILES | CCCCC12CCN(CC3CCC3)C(Cc3ccc(OCOCCOC)c(O)c31)C2(C)O |
| InChI | InChI=1S/C26H41NO5/c1-4-5-11-26-12-13-27(17-19-7-6-8-19)22(25(26,2)29)16-20-9-10-21(24(28)23(20)26)32-18-31-15-14-30-3/h9-10,19,22,28-29H,4-8,11-18H2,1-3H3 |
| InChIKey | GXJAMZIRKDOOOJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|