C30H45NO8 — CID 121326681
(4aS,7aR,12bS)-3-(cyclobutylmethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 121326681) has the molecular formula C30H45NO8 and a molecular weight of 547.69 g/mol. Its IUPAC name is (4aS,7aR,12bS)-3-(cyclobutylmethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4aS,7aR,12bS)-3-(cyclobutylmethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 121326681 |
| Molecular Formula | C30H45NO8 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | (4aS,7aR,12bS)-3-(cyclobutylmethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | COCCOCCOCCOCCOC1CC[C@@]2(O)C3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CCC2)[C@H]1O5 |
| InChI | InChI=1S/C30H45NO8/c1-34-11-12-35-13-14-36-15-16-37-17-18-38-24-7-8-30(33)25-19-22-5-6-23(32)27-26(22)29(30,28(24)39-27)9-10-31(25)20-21-3-2-4-21/h5-6,21,24-25,28,32-33H,2-4,7-20H2,1H3/t24?,25?,28-,29-,30+/m0/s1 |
| InChIKey | RFCKLHPGVPBTOH-RCDMHPICSA-N |
| XLogP | 2.43 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|