C33H51NO7 — CID 146825767
(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 146825767) has the molecular formula C33H51NO7 and a molecular weight of 573.77 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 146825767 |
| Molecular Formula | C33H51NO7 |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 573.37 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | CCCOCCOCCOCCOCCO[C@H]1CC[C@@]2(O)[C@H]3Cc4ccc(C)c5c4[C@@]2(CCN3CC2CCC2)[C@H]1O5 |
| InChI | InChI=1S/C33H51NO7/c1-3-13-36-14-15-37-16-17-38-18-19-39-20-21-40-27-9-10-33(35)28-22-26-8-7-24(2)30-29(26)32(33,31(27)41-30)11-12-34(28)23-25-5-4-6-25/h7-8,25,27-28,31,35H,3-6,9-23H2,1-2H3/t27-,28+,31-,32-,33+/m0/s1 |
| InChIKey | SCYBFVGQWWRTBW-FICMRAMMSA-N |
| XLogP | 3.81 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|