C31H47NO6 — CID 70907574
(4R,4aS,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 70907574) has the molecular formula C31H47NO6 and a molecular weight of 529.72 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,4aS,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 70907574 |
| Molecular Formula | C31H47NO6 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(cyclobutylmethyl)-9-methyl-7-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | CCCOCCOCCOCCOC1CC[C@@]2(O)[C@H]3Cc4ccc(C)c5c4[C@@]2(CCN3CC2CCC2)[C@H]1O5 |
| InChI | InChI=1S/C31H47NO6/c1-3-13-34-14-15-35-16-17-36-18-19-37-25-9-10-31(33)26-20-24-8-7-22(2)28-27(24)30(31,29(25)38-28)11-12-32(26)21-23-5-4-6-23/h7-8,23,25-26,29,33H,3-6,9-21H2,1-2H3/t25?,26-,29+,30+,31-/m1/s1 |
| InChIKey | ZKJWMZTWQWXNKN-NPJHAILXSA-N |
| XLogP | 3.79 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|