C22H26N2O3 — CID 58049296
(4R,12bS)-3-(cyclobutylmethyl)-9-isocyano-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol (PubChem CID 58049296) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4R,12bS)-3-(cyclobutylmethyl)-9-isocyano-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol.
| Compound Name | (4R,12bS)-3-(cyclobutylmethyl)-9-isocyano-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
|---|---|
| PubChem CID | 58049296 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (4R,12bS)-3-(cyclobutylmethyl)-9-isocyano-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
| SMILES | [C-]#[N+]c1ccc2c3c1OC1C(O)CCC4(O)[C@@H](C2)N(CC2CCC2)CC[C@]314 |
| InChI | InChI=1S/C22H26N2O3/c1-23-15-6-5-14-11-17-22(26)8-7-16(25)20-21(22,18(14)19(15)27-20)9-10-24(17)12-13-3-2-4-13/h5-6,13,16-17,20,25-26H,2-4,7-12H2/t16?,17-,20?,21+,22?/m1/s1 |
| InChIKey | HGDILEZFKKMZJD-VNQBBMSWSA-N |
| XLogP | 2.55 |
| TPSA | 57.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|