C22H28N2O4 — CID 75054725
3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 75054725) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | 3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 75054725 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-(cyclobutylmethyl)-4a,7-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | NC(=O)c1ccc2c3c1OC1C(O)CCC4(O)C(C2)N(CC2CCC2)CCC314 |
| InChI | InChI=1S/C22H28N2O4/c23-20(26)14-5-4-13-10-16-22(27)7-6-15(25)19-21(22,17(13)18(14)28-19)8-9-24(16)11-12-2-1-3-12/h4-5,12,15-16,19,25,27H,1-3,6-11H2,(H2,23,26) |
| InChIKey | FCWIXGWALZNKAB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |