C26H30N4O4 — CID 58615199
(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-(1H-pyrrole-2-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 58615199) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-(1H-pyrrole-2-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-(1H-pyrrole-2-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 58615199 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-(1H-pyrrole-2-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | NC(=O)c1ccc2c3c1O[C@H]1[C@H](NC(=O)c4ccc[nH]4)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C26H30N4O4/c27-23(31)16-6-5-15-12-19-26(33)8-7-17(29-24(32)18-2-1-10-28-18)22-25(26,20(15)21(16)34-22)9-11-30(19)13-14-3-4-14/h1-2,5-6,10,14,17,19,22,28,33H,3-4,7-9,11-13H2,(H2,27,31)(H,29,32)/t17-,19-,22+,25+,26-/m1/s1 |
| InChIKey | OCCRAAVOCUVMOF-ZWYCMCHFSA-N |
| XLogP | 1.48 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |