C24H33NO5 — CID 59200819
(4R,4aS,7S,12bS)-3-(cyclobutylmethyl)-7-(2-methoxyethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 59200819) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is (4R,4aS,7S,12bS)-3-(cyclobutylmethyl)-7-(2-methoxyethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7S,12bS)-3-(cyclobutylmethyl)-7-(2-methoxyethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 59200819 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (4R,4aS,7S,12bS)-3-(cyclobutylmethyl)-7-(2-methoxyethoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | COCCO[C@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CCC2)C1O5 |
| InChI | InChI=1S/C24H33NO5/c1-28-11-12-29-18-7-8-24(27)19-13-16-5-6-17(26)21-20(16)23(24,22(18)30-21)9-10-25(19)14-15-3-2-4-15/h5-6,15,18-19,22,26-27H,2-4,7-14H2,1H3/t18-,19+,22?,23-,24+/m0/s1 |
| InChIKey | OZWWDGAAOOXIRQ-HUUSMOERSA-N |
| XLogP | 2.38 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|