C20H26ClNO4 — CID 46232166
(1R,5S,6R,14S)-6-(cyclopropylmethylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one;hydrochloride (PubChem CID 46232166) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is (1R,5S,6R,14S)-6-(cyclopropylmethylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one;hydrochloride.
| Compound Name | (1R,5S,6R,14S)-6-(cyclopropylmethylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one;hydrochloride |
|---|---|
| PubChem CID | 46232166 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (1R,5S,6R,14S)-6-(cyclopropylmethylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one;hydrochloride |
| SMILES | CC[C@]12c3c4ccc(O)c3O[C@H]1C(=O)CC[C@@]2(O)[C@H](NCC1CC1)C4.Cl |
| InChI | InChI=1S/C20H25NO4.ClH/c1-2-19-16-12-5-6-13(22)17(16)25-18(19)14(23)7-8-20(19,24)15(9-12)21-10-11-3-4-11;/h5-6,11,15,18,21-22,24H,2-4,7-10H2,1H3;1H/t15-,18+,19+,20-;/m1./s1 |
| InChIKey | ZBCRIISHZLGFCK-ITLPAZOVSA-N |
| XLogP | 2.24 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |