C20H27NO4 — CID 71042855
(1R,5S,14S)-6-(tert-butylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one (PubChem CID 71042855) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1R,5S,14S)-6-(tert-butylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one.
| Compound Name | (1R,5S,14S)-6-(tert-butylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one |
|---|---|
| PubChem CID | 71042855 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (1R,5S,14S)-6-(tert-butylamino)-14-ethyl-5,11-dihydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one |
| SMILES | CC[C@]12c3c4ccc(O)c3O[C@H]1C(=O)CC[C@@]2(O)C(NC(C)(C)C)C4 |
| InChI | InChI=1S/C20H27NO4/c1-5-19-15-11-6-7-12(22)16(15)25-17(19)13(23)8-9-20(19,24)14(10-11)21-18(2,3)4/h6-7,14,17,21-22,24H,5,8-10H2,1-4H3/t14?,17-,19-,20+/m0/s1 |
| InChIKey | KWTUWPQAKOEVMS-DJGIMKDFSA-N |
| XLogP | 2.21 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |