C25H25NO5 — CID 146389958
[(1S,2S,3R,11R)-17-(cyclopropylmethyl)-2-hydroxy-12-oxo-10-oxa-17-azahexacyclo[7.6.1.13,14.01,11.02,14.05,16]heptadeca-5(16),6,8-trien-8-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 146389958) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [(1S,2S,3R,11R)-17-(cyclopropylmethyl)-2-hydroxy-12-oxo-10-oxa-17-azahexacyclo[7.6.1.13,14.01,11.02,14.05,16]heptadeca-5(16),6,8-trien-8-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(1S,2S,3R,11R)-17-(cyclopropylmethyl)-2-hydroxy-12-oxo-10-oxa-17-azahexacyclo[7.6.1.13,14.01,11.02,14.05,16]heptadeca-5(16),6,8-trien-8-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 146389958 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(1S,2S,3R,11R)-17-(cyclopropylmethyl)-2-hydroxy-12-oxo-10-oxa-17-azahexacyclo[7.6.1.13,14.01,11.02,14.05,16]heptadeca-5(16),6,8-trien-8-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)Oc1ccc2c3c1O[C@H]1C(=O)CC45C[C@]31[C@]4(O)[C@@H](C2)N5CC1CC1 |
| InChI | InChI=1S/C25H25NO5/c1-2-3-4-5-19(28)30-17-9-8-15-10-18-25(29)23(26(18)12-14-6-7-14)11-16(27)22-24(25,13-23)20(15)21(17)31-22/h2-5,8-9,14,18,22,29H,6-7,10-13H2,1H3/b3-2+,5-4+/t18-,22+,23?,24+,25+/m1/s1 |
| InChIKey | DVOKFZFFVYGHCZ-KEBFKYNISA-N |
| XLogP | 2.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|