C41H44N2O9 — CID 10078491
bis[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] carbonate (PubChem CID 10078491) has the molecular formula C41H44N2O9 and a molecular weight of 708.81 g/mol. Its IUPAC name is bis[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] carbonate.
| Compound Name | bis[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] carbonate |
|---|---|
| PubChem CID | 10078491 |
| Molecular Formula | C41H44N2O9 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.30 |
| IUPAC Name | bis[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] carbonate |
| SMILES | O=C(Oc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314)Oc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C41H44N2O9/c44-25-9-11-40(47)29-17-23-5-7-27(33-31(23)38(40,35(25)51-33)13-15-42(29)19-21-1-2-21)49-37(46)50-28-8-6-24-18-30-41(48)12-10-26(45)36-39(41,32(24)34(28)52-36)14-16-43(30)20-22-3-4-22/h5-8,21-22,29-30,35-36,47-48H,1-4,9-20H2/t29-,30-,35+,36+,38+,39+,40-,41-/m1/s1 |
| InChIKey | USKAQXKRPNQAOE-BWEHYDGWSA-N |
| XLogP | 3.53 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|