C25H31NO6 — CID 53477124
[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] tert-butyl carbonate (PubChem CID 53477124) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] tert-butyl carbonate.
| Compound Name | [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 53477124 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C25H31NO6/c1-23(2,3)32-22(28)30-17-7-6-15-12-18-25(29)9-8-16(27)21-24(25,19(15)20(17)31-21)10-11-26(18)13-14-4-5-14/h6-7,14,18,21,29H,4-5,8-13H2,1-3H3/t18-,21+,24+,25-/m1/s1 |
| InChIKey | LQUWMENAOKUEHB-UQRMEHQUSA-N |
| XLogP | 3.13 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|