C20H22FNO6S — CID 130202181
(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-fluorosulfonyloxy-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 130202181) has the molecular formula C20H22FNO6S and a molecular weight of 423.46 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-fluorosulfonyloxy-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-fluorosulfonyloxy-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 130202181 |
| Molecular Formula | C20H22FNO6S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-fluorosulfonyloxy-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | O=C1CC[C@@]2(O)[C@H]3Cc4ccc(OS(=O)(=O)F)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C20H22FNO6S/c21-29(25,26)28-14-4-3-12-9-15-20(24)6-5-13(23)18-19(20,16(12)17(14)27-18)7-8-22(15)10-11-1-2-11/h3-4,11,15,18,24H,1-2,5-10H2/t15-,18+,19+,20-/m1/s1 |
| InChIKey | XQYWURXGZCEDPS-XFWGSAIBSA-N |
| XLogP | 1.41 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |