C31H33NO5 — CID 25257433
[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 25257433) has the molecular formula C31H33NO5 and a molecular weight of 499.61 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 25257433 |
| Molecular Formula | C31H33NO5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(OC(=O)/C=C/c5ccc(C)cc5)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C31H33NO5/c1-19-3-5-20(6-4-19)9-12-26(34)37-31-14-13-23(33)29-30(31)15-16-32(18-21-7-8-21)25(31)17-22-10-11-24(35-2)28(36-29)27(22)30/h3-6,9-12,21,25,29H,7-8,13-18H2,1-2H3/b12-9+/t25-,29+,30+,31-/m1/s1 |
| InChIKey | TUZQURVIVXHNQP-WDGPPKDVSA-N |
| XLogP | 4.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|