C22H25NO6 — CID 69030456
2-[[(4R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]oxy]acetic acid (PubChem CID 69030456) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[[(4R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]oxy]acetic acid.
| Compound Name | 2-[[(4R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 69030456 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[[(4R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]oxy]acetic acid |
| SMILES | O=C(O)COC12CCC(=O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C22H25NO6/c24-14-4-3-13-9-16-22(28-11-17(26)27)6-5-15(25)20-21(22,18(13)19(14)29-20)7-8-23(16)10-12-1-2-12/h3-4,12,16,20,24H,1-2,5-11H2,(H,26,27)/t16-,20+,21+,22?/m1/s1 |
| InChIKey | XKRFJLFFHWTMJL-FTQGYBLNSA-N |
| XLogP | 1.63 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |