C20H22FNO3 — CID 70504019
(4R,12bS)-3-(cyclopropylmethyl)-4a-fluoro-9-hydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 70504019) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is (4R,12bS)-3-(cyclopropylmethyl)-4a-fluoro-9-hydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,12bS)-3-(cyclopropylmethyl)-4a-fluoro-9-hydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 70504019 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (4R,12bS)-3-(cyclopropylmethyl)-4a-fluoro-9-hydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | O=C1CCC2(F)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)C1O5 |
| InChI | InChI=1S/C20H22FNO3/c21-20-6-5-14(24)18-19(20)7-8-22(10-11-1-2-11)15(20)9-12-3-4-13(23)17(25-18)16(12)19/h3-4,11,15,18,23H,1-2,5-10H2/t15-,18?,19+,20?/m1/s1 |
| InChIKey | WGWDPAJNPIVBIP-CIILZPPKSA-N |
| XLogP | 2.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |