C21H23NO4 — CID 146174393
(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-carbaldehyde (PubChem CID 146174393) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-carbaldehyde.
| Compound Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-carbaldehyde |
|---|---|
| PubChem CID | 146174393 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-carbaldehyde |
| SMILES | O=C[C@@]12CCC(=O)[C@H]3Oc4c(O)ccc5c4[C@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C21H23NO4/c23-11-20-6-5-15(25)19-21(20)7-8-22(10-12-1-2-12)16(20)9-13-3-4-14(24)18(26-19)17(13)21/h3-4,11-12,16,19,24H,1-2,5-10H2/t16-,19-,20-,21-/m1/s1 |
| InChIKey | QOUHDTLABYBTJI-QYRPDUKASA-N |
| XLogP | 1.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|