C30H33NO6 — CID 134502092
[(4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(2-methoxyphenyl)propanoate (PubChem CID 134502092) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is [(4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [(4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 134502092 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [(4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)O[C@@]12CCC(=O)[C@@H]3Oc4c(O)ccc5c4C31CCN(CC1CC1)C2C5 |
| InChI | InChI=1S/C30H33NO6/c1-35-23-5-3-2-4-19(23)9-11-25(34)37-30-13-12-22(33)28-29(30)14-15-31(17-18-6-7-18)24(30)16-20-8-10-21(32)27(36-28)26(20)29/h2-5,8,10,18,24,28,32H,6-7,9,11-17H2,1H3/t24?,28-,29?,30+/m0/s1 |
| InChIKey | AEKDBWJANLSRHO-FKKYHJNPSA-N |
| XLogP | 3.72 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |