C29H30ClNO5 — CID 122630034
[(4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(3-chlorophenyl)propanoate (PubChem CID 122630034) has the molecular formula C29H30ClNO5 and a molecular weight of 508.01 g/mol. Its IUPAC name is [(4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(3-chlorophenyl)propanoate.
| Compound Name | [(4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(3-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 122630034 |
| Molecular Formula | C29H30ClNO5 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | [(4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 3-(3-chlorophenyl)propanoate |
| SMILES | O=C(CCc1cccc(Cl)c1)O[C@@]12CCC(=O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)C2C5 |
| InChI | InChI=1S/C29H30ClNO5/c30-20-3-1-2-17(14-20)6-9-24(34)36-29-11-10-22(33)27-28(29)12-13-31(16-18-4-5-18)23(29)15-19-7-8-21(32)26(35-27)25(19)28/h1-3,7-8,14,18,23,27,32H,4-6,9-13,15-16H2/t23?,27-,28-,29+/m0/s1 |
| InChIKey | AKZQKDKEIVBLSR-PCYNRASCSA-N |
| XLogP | 4.36 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |