C30H36ClNO4 — CID 68540912
(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride (PubChem CID 68540912) has the molecular formula C30H36ClNO4 and a molecular weight of 510.07 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride.
| Compound Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
|---|---|
| PubChem CID | 68540912 |
| Molecular Formula | C30H36ClNO4 |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(OCCCc5ccccc5)[C@@H](C2)N(CC2CC2)CC[C@]314.Cl |
| InChI | InChI=1S/C30H35NO4.ClH/c1-33-24-12-11-22-18-25-30(34-17-5-8-20-6-3-2-4-7-20)14-13-23(32)28-29(30,26(22)27(24)35-28)15-16-31(25)19-21-9-10-21;/h2-4,6-7,11-12,21,25,28H,5,8-10,13-19H2,1H3;1H/t25-,28+,29+,30-;/m1./s1 |
| InChIKey | KSFZIVVPLOARQH-ZUDGBCJFSA-N |
| XLogP | 4.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|