C31H37NO4 — CID 10368193
(4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10368193) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is (4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10368193 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@@]1(C)C(=O)CC[C@@]4(OCCCc5ccccc5)C(C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C31H37NO4/c1-29-26(33)14-15-31(35-18-6-9-21-7-4-3-5-8-21)25-19-23-12-13-24(34-2)28(36-29)27(23)30(29,31)16-17-32(25)20-22-10-11-22/h3-5,7-8,12-13,22,25H,6,9-11,14-20H2,1-2H3/t25?,29-,30-,31+/m0/s1 |
| InChIKey | RSPOZANICXFHEK-XJHIRHBFSA-N |
| XLogP | 4.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|