C27H32BrNO4 — CID 68541581
(4R,4aS,12bR)-9-hydroxy-3,7a-dimethyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrobromide (PubChem CID 68541581) has the molecular formula C27H32BrNO4 and a molecular weight of 514.46 g/mol. Its IUPAC name is (4R,4aS,12bR)-9-hydroxy-3,7a-dimethyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrobromide.
| Compound Name | (4R,4aS,12bR)-9-hydroxy-3,7a-dimethyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrobromide |
|---|---|
| PubChem CID | 68541581 |
| Molecular Formula | C27H32BrNO4 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | (4R,4aS,12bR)-9-hydroxy-3,7a-dimethyl-4a-(3-phenylpropoxy)-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrobromide |
| SMILES | Br.CN1CC[C@]23c4c5ccc(O)c4OC2(C)C(=O)CC[C@@]3(OCCCc2ccccc2)[C@H]1C5 |
| InChI | InChI=1S/C27H31NO4.BrH/c1-25-22(30)12-13-27(31-16-6-9-18-7-4-3-5-8-18)21-17-19-10-11-20(29)24(32-25)23(19)26(25,27)14-15-28(21)2;/h3-5,7-8,10-11,21,29H,6,9,12-17H2,1-2H3;1H/t21-,25?,26+,27-;/m1./s1 |
| InChIKey | ITTOOFDQBRJEQP-DPKIAKAHSA-N |
| XLogP | 4.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|