C35H33ClN2O3 — CID 71460944
(1S,2S,10R,18R)-6-(4-chlorophenyl)-19-methyl-2-(3-phenylpropoxy)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaen-13-ol (PubChem CID 71460944) has the molecular formula C35H33ClN2O3 and a molecular weight of 565.11 g/mol. Its IUPAC name is (1S,2S,10R,18R)-6-(4-chlorophenyl)-19-methyl-2-(3-phenylpropoxy)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaen-13-ol.
| Compound Name | (1S,2S,10R,18R)-6-(4-chlorophenyl)-19-methyl-2-(3-phenylpropoxy)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaen-13-ol |
|---|---|
| PubChem CID | 71460944 |
| Molecular Formula | C35H33ClN2O3 |
| Molecular Weight | 565.11 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | (1S,2S,10R,18R)-6-(4-chlorophenyl)-19-methyl-2-(3-phenylpropoxy)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaen-13-ol |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2c2ncc(-c4ccc(Cl)cc4)cc2C[C@@]3(OCCCc2ccccc2)[C@H]1C5 |
| InChI | InChI=1S/C35H33ClN2O3/c1-38-16-15-34-30-24-11-14-28(39)32(30)41-33(34)31-25(18-26(21-37-31)23-9-12-27(36)13-10-23)20-35(34,29(38)19-24)40-17-5-8-22-6-3-2-4-7-22/h2-4,6-7,9-14,18,21,29,33,39H,5,8,15-17,19-20H2,1H3/t29-,33+,34+,35-/m1/s1 |
| InChIKey | AQMQWKFSMIRRJA-OGICNVKRSA-N |
| XLogP | 6.68 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.11 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|