C32H34N2O4 — CID 25056220
(E)-1-[(1S,2S,9R,17S)-12-hydroxy-2-methoxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one (PubChem CID 25056220) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is (E)-1-[(1S,2S,9R,17S)-12-hydroxy-2-methoxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one.
| Compound Name | (E)-1-[(1S,2S,9R,17S)-12-hydroxy-2-methoxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one |
|---|---|
| PubChem CID | 25056220 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (E)-1-[(1S,2S,9R,17S)-12-hydroxy-2-methoxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one |
| SMILES | CO[C@@]12Cc3cc(/C=C/C(=O)CCc4ccccc4)n(C)c3[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@H]2C5 |
| InChI | InChI=1S/C32H34N2O4/c1-33-16-15-31-27-21-10-14-25(36)29(27)38-30(31)28-22(19-32(31,37-3)26(33)18-21)17-23(34(28)2)11-13-24(35)12-9-20-7-5-4-6-8-20/h4-8,10-11,13-14,17,26,30,36H,9,12,15-16,18-19H2,1-3H3/b13-11+/t26-,30-,31-,32+/m0/s1 |
| InChIKey | OCWMEIHWFNFCKF-JOUKLGNJSA-N |
| XLogP | 4.52 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|